C11H20N2OS — CID 106815851
2-[2-(2-ethoxyethyl)-1,3-thiazol-4-yl]-N-ethylethanamine (PubChem CID 106815851) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethyl)-1,3-thiazol-4-yl]-N-ethylethanamine.
| Compound Name | 2-[2-(2-ethoxyethyl)-1,3-thiazol-4-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 106815851 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2-[2-(2-ethoxyethyl)-1,3-thiazol-4-yl]-N-ethylethanamine |
| SMILES | CCNCCc1csc(CCOCC)n1 |
| InChI | InChI=1S/C11H20N2OS/c1-3-12-7-5-10-9-15-11(13-10)6-8-14-4-2/h9,12H,3-8H2,1-2H3 |
| InChIKey | XIDFHQKHNSFOBK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|