C10H18N2OS — CID 62450594
N-[[4-(propoxymethyl)-1,3-thiazol-2-yl]methyl]ethanamine (PubChem CID 62450594) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is N-[[4-(propoxymethyl)-1,3-thiazol-2-yl]methyl]ethanamine.
| Compound Name | N-[[4-(propoxymethyl)-1,3-thiazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 62450594 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | N-[[4-(propoxymethyl)-1,3-thiazol-2-yl]methyl]ethanamine |
| SMILES | CCCOCc1csc(CNCC)n1 |
| InChI | InChI=1S/C10H18N2OS/c1-3-5-13-7-9-8-14-10(12-9)6-11-4-2/h8,11H,3-7H2,1-2H3 |
| InChIKey | YIODHQKTNOSMNN-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|