C14H14F2N2O2S — CID 103486013
ethyl 3-[2-(3,5-difluoroanilino)-1,3-thiazol-4-yl]propanoate (PubChem CID 103486013) has the molecular formula C14H14F2N2O2S and a molecular weight of 312.34 g/mol. Its IUPAC name is ethyl 3-[2-(3,5-difluoroanilino)-1,3-thiazol-4-yl]propanoate.
| Compound Name | ethyl 3-[2-(3,5-difluoroanilino)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 103486013 |
| Molecular Formula | C14H14F2N2O2S |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | ethyl 3-[2-(3,5-difluoroanilino)-1,3-thiazol-4-yl]propanoate |
| SMILES | CCOC(=O)CCc1csc(Nc2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C14H14F2N2O2S/c1-2-20-13(19)4-3-11-8-21-14(17-11)18-12-6-9(15)5-10(16)7-12/h5-8H,2-4H2,1H3,(H,17,18) |
| InChIKey | MWPGGURCLYEKCG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |