methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate

C15H18N2O2S — CID 107039928

IUPACmethyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate
SMILESCOC(=O)CCc1csc(Nc2cc(C)cc(C)c2)n1
InChIInChI=1S/C15H18N2O2S/c1-10-6-11(2)8-13(7-10)17-15-16-12(9-20-15)4-5-14(18)19-3/h6-9H,4-5H2,1-3H3,(H,16,17)
InChIKeySCKIBDVDOVMJHR-UHFFFAOYSA-N
MW290.39 g/mol
LogP3.61
Rot. Bonds5

About methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate

methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate (PubChem CID 107039928) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate.

Molecular Properties

Compound Namemethyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate
PubChem CID107039928
Molecular FormulaC15H18N2O2S
Molecular Weight290.39 g/mol
Exact Mass290.11
IUPAC Namemethyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate
SMILESCOC(=O)CCc1csc(Nc2cc(C)cc(C)c2)n1
InChIInChI=1S/C15H18N2O2S/c1-10-6-11(2)8-13(7-10)17-15-16-12(9-20-15)4-5-14(18)19-3/h6-9H,4-5H2,1-3H3,(H,16,17)
InChIKeySCKIBDVDOVMJHR-UHFFFAOYSA-N
XLogP3.61
TPSA51.22 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.39
LogP ≤ 53.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate?
The IUPAC name of methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate (CID 107039928) is methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate.
What is the SMILES notation for methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate?
The canonical SMILES for methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate is COC(=O)CCc1csc(Nc2cc(C)cc(C)c2)n1.
What is the InChIKey of methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate?
The InChIKey is SCKIBDVDOVMJHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O2S/c1-10-6-11(2)8-13(7-10)17-15-16-12(9-20-15)4-5-14(18)19-3/h6-9H,4-5H2,1-3H3,(H,16,17).
What are the key properties of methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate?
methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate has a molecular weight of 290.39 g/mol, XLogP of 3.61, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(3,5-dimethylanilino)-1,3-thiazol-4-yl]propanoate is sourced from PubChem (CID 107039928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).