C14H15ClN2O2S — CID 107039867
methyl 3-[2-(3-chloro-4-methylanilino)-1,3-thiazol-4-yl]propanoate (PubChem CID 107039867) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is methyl 3-[2-(3-chloro-4-methylanilino)-1,3-thiazol-4-yl]propanoate.
| Compound Name | methyl 3-[2-(3-chloro-4-methylanilino)-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 107039867 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | methyl 3-[2-(3-chloro-4-methylanilino)-1,3-thiazol-4-yl]propanoate |
| SMILES | COC(=O)CCc1csc(Nc2ccc(C)c(Cl)c2)n1 |
| InChI | InChI=1S/C14H15ClN2O2S/c1-9-3-4-10(7-12(9)15)16-14-17-11(8-20-14)5-6-13(18)19-2/h3-4,7-8H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | XZBRRXMUKWYGDK-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |