C14H15BrN2O3S — CID 82859828
ethyl 2-[2-(3-bromo-5-methoxyanilino)-1,3-thiazol-4-yl]acetate (PubChem CID 82859828) has the molecular formula C14H15BrN2O3S and a molecular weight of 371.26 g/mol. Its IUPAC name is ethyl 2-[2-(3-bromo-5-methoxyanilino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(3-bromo-5-methoxyanilino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 82859828 |
| Molecular Formula | C14H15BrN2O3S |
| Molecular Weight | 371.26 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | ethyl 2-[2-(3-bromo-5-methoxyanilino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(Nc2cc(Br)cc(OC)c2)n1 |
| InChI | InChI=1S/C14H15BrN2O3S/c1-3-20-13(18)7-11-8-21-14(17-11)16-10-4-9(15)5-12(6-10)19-2/h4-6,8H,3,7H2,1-2H3,(H,16,17) |
| InChIKey | AYFBSMXRBPKBEO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.26 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |