C13H11BrCl2N2O2S — CID 80573862
ethyl 2-[2-(4-bromo-2,6-dichloroanilino)-1,3-thiazol-4-yl]acetate (PubChem CID 80573862) has the molecular formula C13H11BrCl2N2O2S and a molecular weight of 410.12 g/mol. Its IUPAC name is ethyl 2-[2-(4-bromo-2,6-dichloroanilino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(4-bromo-2,6-dichloroanilino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 80573862 |
| Molecular Formula | C13H11BrCl2N2O2S |
| Molecular Weight | 410.12 g/mol |
| Exact Mass | 407.91 |
| IUPAC Name | ethyl 2-[2-(4-bromo-2,6-dichloroanilino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(Nc2c(Cl)cc(Br)cc2Cl)n1 |
| InChI | InChI=1S/C13H11BrCl2N2O2S/c1-2-20-11(19)5-8-6-21-13(17-8)18-12-9(15)3-7(14)4-10(12)16/h3-4,6H,2,5H2,1H3,(H,17,18) |
| InChIKey | VHSSMEKUUNPLJX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.12 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |