C8H13ClN2S — CID 83186786
N-(4-chlorobutan-2-yl)-4-methyl-1,3-thiazol-2-amine (PubChem CID 83186786) has the molecular formula C8H13ClN2S and a molecular weight of 204.73 g/mol. Its IUPAC name is N-(4-chlorobutan-2-yl)-4-methyl-1,3-thiazol-2-amine.
| Compound Name | N-(4-chlorobutan-2-yl)-4-methyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 83186786 |
| Molecular Formula | C8H13ClN2S |
| Molecular Weight | 204.73 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | N-(4-chlorobutan-2-yl)-4-methyl-1,3-thiazol-2-amine |
| SMILES | Cc1csc(NC(C)CCCl)n1 |
| InChI | InChI=1S/C8H13ClN2S/c1-6(3-4-9)10-8-11-7(2)5-12-8/h5-6H,3-4H2,1-2H3,(H,10,11) |
| InChIKey | YLNKSOOPVYAEQA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.73 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|