C16H16Br2O3 — CID 65152583
6-bromo-7-[bromo-(2,4,5-trimethylfuran-3-yl)methyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 65152583) has the molecular formula C16H16Br2O3 and a molecular weight of 416.11 g/mol. Its IUPAC name is 6-bromo-7-[bromo-(2,4,5-trimethylfuran-3-yl)methyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-bromo-7-[bromo-(2,4,5-trimethylfuran-3-yl)methyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 65152583 |
| Molecular Formula | C16H16Br2O3 |
| Molecular Weight | 416.11 g/mol |
| Exact Mass | 413.95 |
| IUPAC Name | 6-bromo-7-[bromo-(2,4,5-trimethylfuran-3-yl)methyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | Cc1oc(C)c(C(Br)c2cc3c(cc2Br)OCCO3)c1C |
| InChI | InChI=1S/C16H16Br2O3/c1-8-9(2)21-10(3)15(8)16(18)11-6-13-14(7-12(11)17)20-5-4-19-13/h6-7,16H,4-5H2,1-3H3 |
| InChIKey | ZQHHSYRTOANZDN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.11 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|