C10H9Cl2N — CID 146551409
2,4-dichloro-3-propan-2-ylbenzonitrile (PubChem CID 146551409) has the molecular formula C10H9Cl2N and a molecular weight of 214.09 g/mol. Its IUPAC name is 2,4-dichloro-3-propan-2-ylbenzonitrile.
| Compound Name | 2,4-dichloro-3-propan-2-ylbenzonitrile |
|---|---|
| PubChem CID | 146551409 |
| Molecular Formula | C10H9Cl2N |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 2,4-dichloro-3-propan-2-ylbenzonitrile |
| SMILES | CC(C)c1c(Cl)ccc(C#N)c1Cl |
| InChI | InChI=1S/C10H9Cl2N/c1-6(2)9-8(11)4-3-7(5-13)10(9)12/h3-4,6H,1-2H3 |
| InChIKey | GAFDZUGMKNEVKP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |