C10H15ClN2 — CID 130854028
(1S)-1-(2-chloro-6-methylphenyl)propane-1,3-diamine (PubChem CID 130854028) has the molecular formula C10H15ClN2 and a molecular weight of 198.70 g/mol. Its IUPAC name is (1S)-1-(2-chloro-6-methylphenyl)propane-1,3-diamine.
| Compound Name | (1S)-1-(2-chloro-6-methylphenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 130854028 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | (1S)-1-(2-chloro-6-methylphenyl)propane-1,3-diamine |
| SMILES | Cc1cccc(Cl)c1[C@@H](N)CCN |
| InChI | InChI=1S/C10H15ClN2/c1-7-3-2-4-8(11)10(7)9(13)5-6-12/h2-4,9H,5-6,12-13H2,1H3/t9-/m0/s1 |
| InChIKey | COPIRHMTFDHYSI-VIFPVBQESA-N |
| XLogP | 2.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |