C13H13N7O2 — CID 170827036
5-amino-1-[4-(3-azido-1,2-dihydroxypropyl)phenyl]pyrazole-4-carbonitrile (PubChem CID 170827036) has the molecular formula C13H13N7O2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 5-amino-1-[4-(3-azido-1,2-dihydroxypropyl)phenyl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-[4-(3-azido-1,2-dihydroxypropyl)phenyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 170827036 |
| Molecular Formula | C13H13N7O2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 5-amino-1-[4-(3-azido-1,2-dihydroxypropyl)phenyl]pyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(-c2ccc(C(O)C(O)CN=[N+]=[N-])cc2)c1N |
| InChI | InChI=1S/C13H13N7O2/c14-5-9-6-18-20(13(9)15)10-3-1-8(2-4-10)12(22)11(21)7-17-19-16/h1-4,6,11-12,21-22H,7,15H2 |
| InChIKey | VJRFHEHFRRXSTR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 156.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|