C21H31BO4 — CID 102499537
2-[4-[[(3R,5R)-1,10-dioxaspiro[4.5]decan-3-yl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102499537) has the molecular formula C21H31BO4 and a molecular weight of 358.29 g/mol. Its IUPAC name is 2-[4-[[(3R,5R)-1,10-dioxaspiro[4.5]decan-3-yl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-[[(3R,5R)-1,10-dioxaspiro[4.5]decan-3-yl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102499537 |
| Molecular Formula | C21H31BO4 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | 2-[4-[[(3R,5R)-1,10-dioxaspiro[4.5]decan-3-yl]methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(C[C@H]3CO[C@]4(CCCCO4)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C21H31BO4/c1-19(2)20(3,4)26-22(25-19)18-9-7-16(8-10-18)13-17-14-21(24-15-17)11-5-6-12-23-21/h7-10,17H,5-6,11-15H2,1-4H3/t17-,21-/m1/s1 |
| InChIKey | CHKWMYPEKWTQML-DYESRHJHSA-N |
| XLogP | 3.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|