C22H30BF3O6S — CID 153404229
2-[4-(1,4-dioxaspiro[4.5]decan-8-ylmethylsulfonyl)-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 153404229) has the molecular formula C22H30BF3O6S and a molecular weight of 490.35 g/mol. Its IUPAC name is 2-[4-(1,4-dioxaspiro[4.5]decan-8-ylmethylsulfonyl)-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(1,4-dioxaspiro[4.5]decan-8-ylmethylsulfonyl)-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 153404229 |
| Molecular Formula | C22H30BF3O6S |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 2-[4-(1,4-dioxaspiro[4.5]decan-8-ylmethylsulfonyl)-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(S(=O)(=O)CC3CCC4(CC3)OCCO4)c(C(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C22H30BF3O6S/c1-19(2)20(3,4)32-23(31-19)16-5-6-18(17(13-16)22(24,25)26)33(27,28)14-15-7-9-21(10-8-15)29-11-12-30-21/h5-6,13,15H,7-12,14H2,1-4H3 |
| InChIKey | BOMAKCWMAKMJRY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|