C24H32BNO7 — CID 118990940
1-O-tert-butyl 2-O-[(4-methoxyphenyl)methyl] 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1,2-dicarboxylate (PubChem CID 118990940) has the molecular formula C24H32BNO7 and a molecular weight of 457.33 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[(4-methoxyphenyl)methyl] 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[(4-methoxyphenyl)methyl] 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 118990940 |
| Molecular Formula | C24H32BNO7 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | 1-O-tert-butyl 2-O-[(4-methoxyphenyl)methyl] 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrole-1,2-dicarboxylate |
| SMILES | COc1ccc(COC(=O)c2cc(B3OC(C)(C)C(C)(C)O3)cn2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H32BNO7/c1-22(2,3)31-21(28)26-14-17(25-32-23(4,5)24(6,7)33-25)13-19(26)20(27)30-15-16-9-11-18(29-8)12-10-16/h9-14H,15H2,1-8H3 |
| InChIKey | WBFSAVYRBYGACL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 85.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|