C36H36F6N2O8 — CID 139090230
2-O-benzyl 1-O-tert-butyl 4-(trifluoromethyl)pyrrole-1,2-dicarboxylate (PubChem CID 139090230) has the molecular formula C36H36F6N2O8 and a molecular weight of 738.68 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl 4-(trifluoromethyl)pyrrole-1,2-dicarboxylate.
| Compound Name | 2-O-benzyl 1-O-tert-butyl 4-(trifluoromethyl)pyrrole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139090230 |
| Molecular Formula | C36H36F6N2O8 |
| Molecular Weight | 738.68 g/mol |
| Exact Mass | 738.24 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl 4-(trifluoromethyl)pyrrole-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(C(F)(F)F)cc1C(=O)OCc1ccccc1.CC(C)(C)OC(=O)n1cc(C(F)(F)F)cc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/2C18H18F3NO4/c2*1-17(2,3)26-16(24)22-10-13(18(19,20)21)9-14(22)15(23)25-11-12-7-5-4-6-8-12/h2*4-10H,11H2,1-3H3 |
| InChIKey | LZXHDRHITFEMNS-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 115.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.68 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|