C20H19IN2O4 — CID 142728122
5-O-benzyl 1-O-tert-butyl 3-iodopyrrolo[2,3-b]pyridine-1,5-dicarboxylate (PubChem CID 142728122) has the molecular formula C20H19IN2O4 and a molecular weight of 478.29 g/mol. Its IUPAC name is 5-O-benzyl 1-O-tert-butyl 3-iodopyrrolo[2,3-b]pyridine-1,5-dicarboxylate.
| Compound Name | 5-O-benzyl 1-O-tert-butyl 3-iodopyrrolo[2,3-b]pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 142728122 |
| Molecular Formula | C20H19IN2O4 |
| Molecular Weight | 478.29 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | 5-O-benzyl 1-O-tert-butyl 3-iodopyrrolo[2,3-b]pyridine-1,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(I)c2cc(C(=O)OCc3ccccc3)cnc21 |
| InChI | InChI=1S/C20H19IN2O4/c1-20(2,3)27-19(25)23-11-16(21)15-9-14(10-22-17(15)23)18(24)26-12-13-7-5-4-6-8-13/h4-11H,12H2,1-3H3 |
| InChIKey | WPWNPUGQHLGUMI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|