C28H26IN3O6 — CID 167488870
tert-butyl 6-[bis(phenylmethoxycarbonyl)amino]-2-iodopyrrolo[3,2-c]pyridine-1-carboxylate (PubChem CID 167488870) has the molecular formula C28H26IN3O6 and a molecular weight of 627.44 g/mol. Its IUPAC name is tert-butyl 6-[bis(phenylmethoxycarbonyl)amino]-2-iodopyrrolo[3,2-c]pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-[bis(phenylmethoxycarbonyl)amino]-2-iodopyrrolo[3,2-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 167488870 |
| Molecular Formula | C28H26IN3O6 |
| Molecular Weight | 627.44 g/mol |
| Exact Mass | 627.09 |
| IUPAC Name | tert-butyl 6-[bis(phenylmethoxycarbonyl)amino]-2-iodopyrrolo[3,2-c]pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(I)cc2cnc(N(C(=O)OCc3ccccc3)C(=O)OCc3ccccc3)cc21 |
| InChI | InChI=1S/C28H26IN3O6/c1-28(2,3)38-27(35)31-22-15-24(30-16-21(22)14-23(31)29)32(25(33)36-17-19-10-6-4-7-11-19)26(34)37-18-20-12-8-5-9-13-20/h4-16H,17-18H2,1-3H3 |
| InChIKey | UQTVNSRNIPNNTE-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.44 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|