C39H48ClN3O7Si — CID 123676597
N-(1-azabicyclo[2.2.1]heptan-4-ylmethyl)-5-chloro-6,7-bis[(4-methoxyphenyl)methoxy]-4-oxo-1-(2-trimethylsilylethoxymethyl)quinoline-3-carboxamide (PubChem CID 123676597) has the molecular formula C39H48ClN3O7Si and a molecular weight of 734.37 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.1]heptan-4-ylmethyl)-5-chloro-6,7-bis[(4-methoxyphenyl)methoxy]-4-oxo-1-(2-trimethylsilylethoxymethyl)quinoline-3-carboxamide.
| Compound Name | N-(1-azabicyclo[2.2.1]heptan-4-ylmethyl)-5-chloro-6,7-bis[(4-methoxyphenyl)methoxy]-4-oxo-1-(2-trimethylsilylethoxymethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 123676597 |
| Molecular Formula | C39H48ClN3O7Si |
| Molecular Weight | 734.37 g/mol |
| Exact Mass | 733.30 |
| IUPAC Name | N-(1-azabicyclo[2.2.1]heptan-4-ylmethyl)-5-chloro-6,7-bis[(4-methoxyphenyl)methoxy]-4-oxo-1-(2-trimethylsilylethoxymethyl)quinoline-3-carboxamide |
| SMILES | COc1ccc(COc2cc3c(c(Cl)c2OCc2ccc(OC)cc2)c(=O)c(C(=O)NCC24CCN(CC2)C4)cn3COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C39H48ClN3O7Si/c1-46-29-10-6-27(7-11-29)22-49-33-20-32-34(35(40)37(33)50-23-28-8-12-30(47-2)13-9-28)36(44)31(21-43(32)26-48-18-19-51(3,4)5)38(45)41-24-39-14-16-42(25-39)17-15-39/h6-13,20-21H,14-19,22-26H2,1-5H3,(H,41,45) |
| InChIKey | ASICAPPDPOZRLY-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.37 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|