C32H36ClNO7Si — CID 123258785
5-chloro-6,7-bis[(4-methoxyphenyl)methoxy]-4-oxo-1-(2-trimethylsilylethoxymethyl)quinoline-3-carbaldehyde (PubChem CID 123258785) has the molecular formula C32H36ClNO7Si and a molecular weight of 610.18 g/mol. Its IUPAC name is 5-chloro-6,7-bis[(4-methoxyphenyl)methoxy]-4-oxo-1-(2-trimethylsilylethoxymethyl)quinoline-3-carbaldehyde.
| Compound Name | 5-chloro-6,7-bis[(4-methoxyphenyl)methoxy]-4-oxo-1-(2-trimethylsilylethoxymethyl)quinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 123258785 |
| Molecular Formula | C32H36ClNO7Si |
| Molecular Weight | 610.18 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | 5-chloro-6,7-bis[(4-methoxyphenyl)methoxy]-4-oxo-1-(2-trimethylsilylethoxymethyl)quinoline-3-carbaldehyde |
| SMILES | COc1ccc(COc2cc3c(c(Cl)c2OCc2ccc(OC)cc2)c(=O)c(C=O)cn3COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C32H36ClNO7Si/c1-37-25-10-6-22(7-11-25)19-40-28-16-27-29(30(33)32(28)41-20-23-8-12-26(38-2)13-9-23)31(36)24(18-35)17-34(27)21-39-14-15-42(3,4)5/h6-13,16-18H,14-15,19-21H2,1-5H3 |
| InChIKey | MUYNHALCABXVJV-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 85.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.18 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|