C29H23N3O6 — CID 101008201
2,8-bis[(4-methoxyphenyl)methyl]-1,9-dioxopyrido[4,3-b][1,6]naphthyridine-4,6-dicarbaldehyde (PubChem CID 101008201) has the molecular formula C29H23N3O6 and a molecular weight of 509.52 g/mol. Its IUPAC name is 2,8-bis[(4-methoxyphenyl)methyl]-1,9-dioxopyrido[4,3-b][1,6]naphthyridine-4,6-dicarbaldehyde.
| Compound Name | 2,8-bis[(4-methoxyphenyl)methyl]-1,9-dioxopyrido[4,3-b][1,6]naphthyridine-4,6-dicarbaldehyde |
|---|---|
| PubChem CID | 101008201 |
| Molecular Formula | C29H23N3O6 |
| Molecular Weight | 509.52 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 2,8-bis[(4-methoxyphenyl)methyl]-1,9-dioxopyrido[4,3-b][1,6]naphthyridine-4,6-dicarbaldehyde |
| SMILES | COc1ccc(Cn2cc(C=O)c3nc4c(C=O)cn(Cc5ccc(OC)cc5)c(=O)c4cc3c2=O)cc1 |
| InChI | InChI=1S/C29H23N3O6/c1-37-22-7-3-18(4-8-22)12-31-14-20(16-33)26-24(28(31)35)11-25-27(30-26)21(17-34)15-32(29(25)36)13-19-5-9-23(38-2)10-6-19/h3-11,14-17H,12-13H2,1-2H3 |
| InChIKey | HVSBCGCPNSVTIH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 109.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|