C17H16ClN3O3 — CID 138633826
7-chloro-2-ethyl-4-[(4-methoxyphenyl)methyl]-5-oxopyrazolo[4,3-b]pyridine-6-carbaldehyde (PubChem CID 138633826) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is 7-chloro-2-ethyl-4-[(4-methoxyphenyl)methyl]-5-oxopyrazolo[4,3-b]pyridine-6-carbaldehyde.
| Compound Name | 7-chloro-2-ethyl-4-[(4-methoxyphenyl)methyl]-5-oxopyrazolo[4,3-b]pyridine-6-carbaldehyde |
|---|---|
| PubChem CID | 138633826 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 7-chloro-2-ethyl-4-[(4-methoxyphenyl)methyl]-5-oxopyrazolo[4,3-b]pyridine-6-carbaldehyde |
| SMILES | CCn1cc2c(n1)c(Cl)c(C=O)c(=O)n2Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H16ClN3O3/c1-3-20-9-14-16(19-20)15(18)13(10-22)17(23)21(14)8-11-4-6-12(24-2)7-5-11/h4-7,9-10H,3,8H2,1-2H3 |
| InChIKey | JBNIPMLUJVSPHC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|