C15H12F2O3 — CID 170431907
2,4-difluoro-3-[(4-methoxyphenyl)methoxy]benzaldehyde (PubChem CID 170431907) has the molecular formula C15H12F2O3 and a molecular weight of 278.25 g/mol. Its IUPAC name is 2,4-difluoro-3-[(4-methoxyphenyl)methoxy]benzaldehyde.
| Compound Name | 2,4-difluoro-3-[(4-methoxyphenyl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 170431907 |
| Molecular Formula | C15H12F2O3 |
| Molecular Weight | 278.25 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2,4-difluoro-3-[(4-methoxyphenyl)methoxy]benzaldehyde |
| SMILES | COc1ccc(COc2c(F)ccc(C=O)c2F)cc1 |
| InChI | InChI=1S/C15H12F2O3/c1-19-12-5-2-10(3-6-12)9-20-15-13(16)7-4-11(8-18)14(15)17/h2-8H,9H2,1H3 |
| InChIKey | KKRCKHSDZDUUHT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|