C24H24Cl2N2O4 — CID 68709090
1-[5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1-methylpyrazol-3-yl]but-3-en-1-ol (PubChem CID 68709090) has the molecular formula C24H24Cl2N2O4 and a molecular weight of 475.37 g/mol. Its IUPAC name is 1-[5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1-methylpyrazol-3-yl]but-3-en-1-ol.
| Compound Name | 1-[5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1-methylpyrazol-3-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 68709090 |
| Molecular Formula | C24H24Cl2N2O4 |
| Molecular Weight | 475.37 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 1-[5-[2,4-dichloro-5-[(4-methoxyphenyl)methoxy]phenoxy]-4-ethenyl-1-methylpyrazol-3-yl]but-3-en-1-ol |
| SMILES | C=CCC(O)c1nn(C)c(Oc2cc(OCc3ccc(OC)cc3)c(Cl)cc2Cl)c1C=C |
| InChI | InChI=1S/C24H24Cl2N2O4/c1-5-7-20(29)23-17(6-2)24(28(3)27-23)32-22-13-21(18(25)12-19(22)26)31-14-15-8-10-16(30-4)11-9-15/h5-6,8-13,20,29H,1-2,7,14H2,3-4H3 |
| InChIKey | XRBGPFWSAGGGSV-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.37 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|