C16H21NO5 — CID 139650443
5-[4-(2,2-dimethylpropanoyloxy)phenyl]-5-hydroxyiminopentanoic acid (PubChem CID 139650443) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is 5-[4-(2,2-dimethylpropanoyloxy)phenyl]-5-hydroxyiminopentanoic acid.
| Compound Name | 5-[4-(2,2-dimethylpropanoyloxy)phenyl]-5-hydroxyiminopentanoic acid |
|---|---|
| PubChem CID | 139650443 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 5-[4-(2,2-dimethylpropanoyloxy)phenyl]-5-hydroxyiminopentanoic acid |
| SMILES | CC(C)(C)C(=O)Oc1ccc(C(CCCC(=O)O)=NO)cc1 |
| InChI | InChI=1S/C16H21NO5/c1-16(2,3)15(20)22-12-9-7-11(8-10-12)13(17-21)5-4-6-14(18)19/h7-10,21H,4-6H2,1-3H3,(H,18,19) |
| InChIKey | SBULXFFPAMUDQX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|