C32H40O7 — CID 173245108
[2-(2,2-dimethylpropanoyloxy)-3,5-dimethoxy-6-(2-methylbut-3-en-2-yl)-4-(3-oxo-3-phenylprop-1-enyl)phenyl] 2,2-dimethylpropanoate (PubChem CID 173245108) has the molecular formula C32H40O7 and a molecular weight of 536.67 g/mol. Its IUPAC name is [2-(2,2-dimethylpropanoyloxy)-3,5-dimethoxy-6-(2-methylbut-3-en-2-yl)-4-(3-oxo-3-phenylprop-1-enyl)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [2-(2,2-dimethylpropanoyloxy)-3,5-dimethoxy-6-(2-methylbut-3-en-2-yl)-4-(3-oxo-3-phenylprop-1-enyl)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 173245108 |
| Molecular Formula | C32H40O7 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | [2-(2,2-dimethylpropanoyloxy)-3,5-dimethoxy-6-(2-methylbut-3-en-2-yl)-4-(3-oxo-3-phenylprop-1-enyl)phenyl] 2,2-dimethylpropanoate |
| SMILES | C=CC(C)(C)c1c(OC)c(C=CC(=O)c2ccccc2)c(OC)c(OC(=O)C(C)(C)C)c1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C32H40O7/c1-12-32(8,9)23-24(36-10)21(18-19-22(33)20-16-14-13-15-17-20)25(37-11)27(39-29(35)31(5,6)7)26(23)38-28(34)30(2,3)4/h12-19H,1H2,2-11H3 |
| InChIKey | XLXHAWVGZNDWNI-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|