C19H20N3O4S- — CID 9242984
2-[[2-methoxy-5-[(Z)-C-methyl-N-(phenylcarbamoylamino)carbonimidoyl]phenyl]methylsulfanyl]acetate (PubChem CID 9242984) has the molecular formula C19H20N3O4S- and a molecular weight of 386.45 g/mol. Its IUPAC name is 2-[[2-methoxy-5-[(Z)-C-methyl-N-(phenylcarbamoylamino)carbonimidoyl]phenyl]methylsulfanyl]acetate.
| Compound Name | 2-[[2-methoxy-5-[(Z)-C-methyl-N-(phenylcarbamoylamino)carbonimidoyl]phenyl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 9242984 |
| Molecular Formula | C19H20N3O4S- |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 2-[[2-methoxy-5-[(Z)-C-methyl-N-(phenylcarbamoylamino)carbonimidoyl]phenyl]methylsulfanyl]acetate |
| SMILES | COc1ccc(/C(C)=N\NC(=O)Nc2ccccc2)cc1CSCC(=O)[O-] |
| InChI | InChI=1S/C19H21N3O4S/c1-13(21-22-19(25)20-16-6-4-3-5-7-16)14-8-9-17(26-2)15(10-14)11-27-12-18(23)24/h3-10H,11-12H2,1-2H3,(H,23,24)(H2,20,22,25)/p-1/b21-13- |
| InChIKey | DFLXUTHGDUGGQU-BKUYFWCQSA-M |
| XLogP | 2.22 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|