C20H15ClF2O4 — CID 47073899
(E)-3-(6-chloro-2H-chromen-3-yl)-1-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-en-1-one (PubChem CID 47073899) has the molecular formula C20H15ClF2O4 and a molecular weight of 392.79 g/mol. Its IUPAC name is (E)-3-(6-chloro-2H-chromen-3-yl)-1-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(6-chloro-2H-chromen-3-yl)-1-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 47073899 |
| Molecular Formula | C20H15ClF2O4 |
| Molecular Weight | 392.79 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | (E)-3-(6-chloro-2H-chromen-3-yl)-1-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1cc(C(=O)/C=C/C2=Cc3cc(Cl)ccc3OC2)ccc1OC(F)F |
| InChI | InChI=1S/C20H15ClF2O4/c1-25-19-10-13(3-6-18(19)27-20(22)23)16(24)5-2-12-8-14-9-15(21)4-7-17(14)26-11-12/h2-10,20H,11H2,1H3/b5-2+ |
| InChIKey | BUXJMIVUCKJDTM-GORDUTHDSA-N |
| XLogP | 5.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.79 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|