C24H23NO4S — CID 19561024
(E)-1-(3,4-dimethoxyphenyl)-3-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]prop-2-en-1-one (PubChem CID 19561024) has the molecular formula C24H23NO4S and a molecular weight of 421.52 g/mol. Its IUPAC name is (E)-1-(3,4-dimethoxyphenyl)-3-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dimethoxyphenyl)-3-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19561024 |
| Molecular Formula | C24H23NO4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (E)-1-(3,4-dimethoxyphenyl)-3-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(OC)c(OC)c2)cc1CSc1ccccn1 |
| InChI | InChI=1S/C24H23NO4S/c1-27-21-11-8-17(14-19(21)16-30-24-6-4-5-13-25-24)7-10-20(26)18-9-12-22(28-2)23(15-18)29-3/h4-15H,16H2,1-3H3/b10-7+ |
| InChIKey | ZKMRQFWLHJDVSL-JXMROGBWSA-N |
| XLogP | 5.30 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|