C26H22N2O2S — CID 19559049
(E)-3-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one (PubChem CID 19559049) has the molecular formula C26H22N2O2S and a molecular weight of 426.54 g/mol. Its IUPAC name is (E)-3-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 19559049 |
| Molecular Formula | C26H22N2O2S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (E)-3-[4-methoxy-3-(pyridin-2-ylsulfanylmethyl)phenyl]-1-(4-pyrrol-1-ylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(-n3cccc3)cc2)cc1CSc1ccccn1 |
| InChI | InChI=1S/C26H22N2O2S/c1-30-25-14-8-20(18-22(25)19-31-26-6-2-3-15-27-26)7-13-24(29)21-9-11-23(12-10-21)28-16-4-5-17-28/h2-18H,19H2,1H3/b13-7+ |
| InChIKey | ZDIMUIDTCCBUMP-NTUHNPAUSA-N |
| XLogP | 6.07 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|