C30H28O3S — CID 19561340
(E)-1-(5-benzylthiophen-2-yl)-3-[3-[(2,6-dimethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one (PubChem CID 19561340) has the molecular formula C30H28O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is (E)-1-(5-benzylthiophen-2-yl)-3-[3-[(2,6-dimethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(5-benzylthiophen-2-yl)-3-[3-[(2,6-dimethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 19561340 |
| Molecular Formula | C30H28O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | (E)-1-(5-benzylthiophen-2-yl)-3-[3-[(2,6-dimethylphenoxy)methyl]-4-methoxyphenyl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccc(Cc3ccccc3)s2)cc1COc1c(C)cccc1C |
| InChI | InChI=1S/C30H28O3S/c1-21-8-7-9-22(2)30(21)33-20-25-18-24(13-16-28(25)32-3)12-15-27(31)29-17-14-26(34-29)19-23-10-5-4-6-11-23/h4-18H,19-20H2,1-3H3/b15-12+ |
| InChIKey | VQJSCIYUBRCNFI-NTCAYCPXSA-N |
| XLogP | 7.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|