C20H28N2O3 — CID 53374537
5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-3-octyl-1,2,4-oxadiazole (PubChem CID 53374537) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-3-octyl-1,2,4-oxadiazole.
| Compound Name | 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-3-octyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 53374537 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 5-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-3-octyl-1,2,4-oxadiazole |
| SMILES | CCCCCCCCc1noc(/C=C/c2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C20H28N2O3/c1-4-5-6-7-8-9-10-19-21-20(25-22-19)14-12-16-11-13-17(23-2)18(15-16)24-3/h11-15H,4-10H2,1-3H3/b14-12+ |
| InChIKey | YCEDLOGLEUYLQP-WYMLVPIESA-N |
| XLogP | 5.16 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|