C34H40N2O — CID 3128917
5-[2-(4-heptylphenyl)ethenyl]-3-[4-(4-pentylphenyl)phenyl]-1,2,4-oxadiazole (PubChem CID 3128917) has the molecular formula C34H40N2O and a molecular weight of 492.71 g/mol. Its IUPAC name is 5-[2-(4-heptylphenyl)ethenyl]-3-[4-(4-pentylphenyl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-[2-(4-heptylphenyl)ethenyl]-3-[4-(4-pentylphenyl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 3128917 |
| Molecular Formula | C34H40N2O |
| Molecular Weight | 492.71 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | 5-[2-(4-heptylphenyl)ethenyl]-3-[4-(4-pentylphenyl)phenyl]-1,2,4-oxadiazole |
| SMILES | CCCCCCCc1ccc(C=Cc2nc(-c3ccc(-c4ccc(CCCCC)cc4)cc3)no2)cc1 |
| InChI | InChI=1S/C34H40N2O/c1-3-5-7-8-10-12-27-13-15-29(16-14-27)19-26-33-35-34(36-37-33)32-24-22-31(23-25-32)30-20-17-28(18-21-30)11-9-6-4-2/h13-26H,3-12H2,1-2H3 |
| InChIKey | GLXVZOKCUCCPRO-UHFFFAOYSA-N |
| XLogP | 9.82 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.71 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|