C20H21Cl2N3O — CID 2800155
5-(2,5-dichloro-3-pyridinyl)-3-(4-heptylphenyl)-1,2,4-oxadiazole (PubChem CID 2800155) has the molecular formula C20H21Cl2N3O and a molecular weight of 390.31 g/mol. Its IUPAC name is 5-(2,5-dichloro-3-pyridinyl)-3-(4-heptylphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-(2,5-dichloro-3-pyridinyl)-3-(4-heptylphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 2800155 |
| Molecular Formula | C20H21Cl2N3O |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 5-(2,5-dichloro-3-pyridinyl)-3-(4-heptylphenyl)-1,2,4-oxadiazole |
| SMILES | CCCCCCCc1ccc(-c2noc(-c3cc(Cl)cnc3Cl)n2)cc1 |
| InChI | InChI=1S/C20H21Cl2N3O/c1-2-3-4-5-6-7-14-8-10-15(11-9-14)19-24-20(26-25-19)17-12-16(21)13-23-18(17)22/h8-13H,2-7H2,1H3 |
| InChIKey | APVVNWNPINAYMP-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|