C29H26ClN3O2 — CID 5154034
5-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-3-[4-(4-pentylphenyl)phenyl]-1,2,4-oxadiazole (PubChem CID 5154034) has the molecular formula C29H26ClN3O2 and a molecular weight of 484.00 g/mol. Its IUPAC name is 5-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-3-[4-(4-pentylphenyl)phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-3-[4-(4-pentylphenyl)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 5154034 |
| Molecular Formula | C29H26ClN3O2 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 5-[3-(2-chlorophenyl)-5-methyl-1,2-oxazol-4-yl]-3-[4-(4-pentylphenyl)phenyl]-1,2,4-oxadiazole |
| SMILES | CCCCCc1ccc(-c2ccc(-c3noc(-c4c(-c5ccccc5Cl)noc4C)n3)cc2)cc1 |
| InChI | InChI=1S/C29H26ClN3O2/c1-3-4-5-8-20-11-13-21(14-12-20)22-15-17-23(18-16-22)28-31-29(35-33-28)26-19(2)34-32-27(26)24-9-6-7-10-25(24)30/h6-7,9-18H,3-5,8H2,1-2H3 |
| InChIKey | PTWMWLZKEIASKJ-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|