C34H42O2 — CID 102415018
4-tert-butyl-2-[(E)-2-[4-[(E)-2-(5-tert-butyl-2-ethoxyphenyl)ethenyl]phenyl]ethenyl]-1-ethoxybenzene (PubChem CID 102415018) has the molecular formula C34H42O2 and a molecular weight of 482.71 g/mol. Its IUPAC name is 4-tert-butyl-2-[(E)-2-[4-[(E)-2-(5-tert-butyl-2-ethoxyphenyl)ethenyl]phenyl]ethenyl]-1-ethoxybenzene.
| Compound Name | 4-tert-butyl-2-[(E)-2-[4-[(E)-2-(5-tert-butyl-2-ethoxyphenyl)ethenyl]phenyl]ethenyl]-1-ethoxybenzene |
|---|---|
| PubChem CID | 102415018 |
| Molecular Formula | C34H42O2 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | 4-tert-butyl-2-[(E)-2-[4-[(E)-2-(5-tert-butyl-2-ethoxyphenyl)ethenyl]phenyl]ethenyl]-1-ethoxybenzene |
| SMILES | CCOc1ccc(C(C)(C)C)cc1/C=C/c1ccc(/C=C/c2cc(C(C)(C)C)ccc2OCC)cc1 |
| InChI | InChI=1S/C34H42O2/c1-9-35-31-21-19-29(33(3,4)5)23-27(31)17-15-25-11-13-26(14-12-25)16-18-28-24-30(34(6,7)8)20-22-32(28)36-10-2/h11-24H,9-10H2,1-8H3/b17-15+,18-16+ |
| InChIKey | GPZZOXFTLVBQLF-YTEMWHBBSA-N |
| XLogP | 9.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|