C13H18BrNO2 — CID 117483390
(E)-3-(2-bromo-3-ethyl-5,6-dimethoxyphenyl)prop-2-en-1-amine (PubChem CID 117483390) has the molecular formula C13H18BrNO2 and a molecular weight of 300.20 g/mol. Its IUPAC name is (E)-3-(2-bromo-3-ethyl-5,6-dimethoxyphenyl)prop-2-en-1-amine.
| Compound Name | (E)-3-(2-bromo-3-ethyl-5,6-dimethoxyphenyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 117483390 |
| Molecular Formula | C13H18BrNO2 |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (E)-3-(2-bromo-3-ethyl-5,6-dimethoxyphenyl)prop-2-en-1-amine |
| SMILES | CCc1cc(OC)c(OC)c(/C=C/CN)c1Br |
| InChI | InChI=1S/C13H18BrNO2/c1-4-9-8-11(16-2)13(17-3)10(12(9)14)6-5-7-15/h5-6,8H,4,7,15H2,1-3H3/b6-5+ |
| InChIKey | QWXHKBBKOXUUFH-AATRIKPKSA-N |
| XLogP | 3.00 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |