C13H18O3 — CID 117318153
3-(4-hydroxy-5-methoxy-2,3-dimethylphenyl)butanal (PubChem CID 117318153) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is 3-(4-hydroxy-5-methoxy-2,3-dimethylphenyl)butanal.
| Compound Name | 3-(4-hydroxy-5-methoxy-2,3-dimethylphenyl)butanal |
|---|---|
| PubChem CID | 117318153 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 3-(4-hydroxy-5-methoxy-2,3-dimethylphenyl)butanal |
| SMILES | COc1cc(C(C)CC=O)c(C)c(C)c1O |
| InChI | InChI=1S/C13H18O3/c1-8(5-6-14)11-7-12(16-4)13(15)10(3)9(11)2/h6-8,15H,5H2,1-4H3 |
| InChIKey | GTWCKGRZHGVMTQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|