C12H19NO4 — CID 117355242
2-amino-2-[2,3-dimethoxy-5-(methoxymethyl)phenyl]ethanol (PubChem CID 117355242) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-amino-2-[2,3-dimethoxy-5-(methoxymethyl)phenyl]ethanol.
| Compound Name | 2-amino-2-[2,3-dimethoxy-5-(methoxymethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 117355242 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-amino-2-[2,3-dimethoxy-5-(methoxymethyl)phenyl]ethanol |
| SMILES | COCc1cc(OC)c(OC)c(C(N)CO)c1 |
| InChI | InChI=1S/C12H19NO4/c1-15-7-8-4-9(10(13)6-14)12(17-3)11(5-8)16-2/h4-5,10,14H,6-7,13H2,1-3H3 |
| InChIKey | ZEXYZGUYOGMXII-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |