C11H16FNO3 — CID 117330301
2-amino-2-[2-fluoro-4-methoxy-5-(methoxymethyl)phenyl]ethanol (PubChem CID 117330301) has the molecular formula C11H16FNO3 and a molecular weight of 229.25 g/mol. Its IUPAC name is 2-amino-2-[2-fluoro-4-methoxy-5-(methoxymethyl)phenyl]ethanol.
| Compound Name | 2-amino-2-[2-fluoro-4-methoxy-5-(methoxymethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 117330301 |
| Molecular Formula | C11H16FNO3 |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-amino-2-[2-fluoro-4-methoxy-5-(methoxymethyl)phenyl]ethanol |
| SMILES | COCc1cc(C(N)CO)c(F)cc1OC |
| InChI | InChI=1S/C11H16FNO3/c1-15-6-7-3-8(10(13)5-14)9(12)4-11(7)16-2/h3-4,10,14H,5-6,13H2,1-2H3 |
| InChIKey | UUCJQYDORMNOIW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |