C8H8Br2N2O4 — CID 66516242
6-[(1R)-1-amino-2-hydroxyethyl]-2,3-dibromo-4-nitrophenol (PubChem CID 66516242) has the molecular formula C8H8Br2N2O4 and a molecular weight of 355.97 g/mol. Its IUPAC name is 6-[(1R)-1-amino-2-hydroxyethyl]-2,3-dibromo-4-nitrophenol.
| Compound Name | 6-[(1R)-1-amino-2-hydroxyethyl]-2,3-dibromo-4-nitrophenol |
|---|---|
| PubChem CID | 66516242 |
| Molecular Formula | C8H8Br2N2O4 |
| Molecular Weight | 355.97 g/mol |
| Exact Mass | 353.89 |
| IUPAC Name | 6-[(1R)-1-amino-2-hydroxyethyl]-2,3-dibromo-4-nitrophenol |
| SMILES | N[C@@H](CO)c1cc([N+](=O)[O-])c(Br)c(Br)c1O |
| InChI | InChI=1S/C8H8Br2N2O4/c9-6-5(12(15)16)1-3(4(11)2-13)8(14)7(6)10/h1,4,13-14H,2,11H2/t4-/m0/s1 |
| InChIKey | ZYCDMHLXGDXQLU-BYPYZUCNSA-N |
| XLogP | 1.82 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.97 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|