C8H8Cl2N2O4 — CID 66515856
6-[(1R)-1-amino-2-hydroxyethyl]-3,4-dichloro-2-nitrophenol (PubChem CID 66515856) has the molecular formula C8H8Cl2N2O4 and a molecular weight of 267.07 g/mol. Its IUPAC name is 6-[(1R)-1-amino-2-hydroxyethyl]-3,4-dichloro-2-nitrophenol.
| Compound Name | 6-[(1R)-1-amino-2-hydroxyethyl]-3,4-dichloro-2-nitrophenol |
|---|---|
| PubChem CID | 66515856 |
| Molecular Formula | C8H8Cl2N2O4 |
| Molecular Weight | 267.07 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | 6-[(1R)-1-amino-2-hydroxyethyl]-3,4-dichloro-2-nitrophenol |
| SMILES | N[C@@H](CO)c1cc(Cl)c(Cl)c([N+](=O)[O-])c1O |
| InChI | InChI=1S/C8H8Cl2N2O4/c9-4-1-3(5(11)2-13)8(14)7(6(4)10)12(15)16/h1,5,13-14H,2,11H2/t5-/m0/s1 |
| InChIKey | CLSAVBNASCNQPQ-YFKPBYRVSA-N |
| XLogP | 1.60 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.07 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|