C18H20N2O10 — CID 91230284
1,1-bis(4,5-dimethoxy-2-nitrophenyl)ethane-1,2-diol (PubChem CID 91230284) has the molecular formula C18H20N2O10 and a molecular weight of 424.36 g/mol. Its IUPAC name is 1,1-bis(4,5-dimethoxy-2-nitrophenyl)ethane-1,2-diol.
| Compound Name | 1,1-bis(4,5-dimethoxy-2-nitrophenyl)ethane-1,2-diol |
|---|---|
| PubChem CID | 91230284 |
| Molecular Formula | C18H20N2O10 |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 1,1-bis(4,5-dimethoxy-2-nitrophenyl)ethane-1,2-diol |
| SMILES | COc1cc([N+](=O)[O-])c(C(O)(CO)c2cc(OC)c(OC)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H20N2O10/c1-27-14-5-10(12(19(23)24)7-16(14)29-3)18(22,9-21)11-6-15(28-2)17(30-4)8-13(11)20(25)26/h5-8,21-22H,9H2,1-4H3 |
| InChIKey | YKSODPZLIYJBJD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 163.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|