C18H31N — CID 143697278
N,4-dimethylaniline;2-methylbut-1-ene;2-methylbut-2-ene (PubChem CID 143697278) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is N,4-dimethylaniline;2-methylbut-1-ene;2-methylbut-2-ene.
| Compound Name | N,4-dimethylaniline;2-methylbut-1-ene;2-methylbut-2-ene |
|---|---|
| PubChem CID | 143697278 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | N,4-dimethylaniline;2-methylbut-1-ene;2-methylbut-2-ene |
| SMILES | C=C(C)CC.CC=C(C)C.CNc1ccc(C)cc1 |
| InChI | InChI=1S/C8H11N.2C5H10/c1-7-3-5-8(9-2)6-4-7;2*1-4-5(2)3/h3-6,9H,1-2H3;4H,1-3H3;2,4H2,1,3H3 |
| InChIKey | OAMBILIPFODOPE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|