C24H44FN — CID 143844335
butane;N,4-dimethylaniline;(2Z,4E)-3-ethyl-4-fluorohexa-2,4-diene (PubChem CID 143844335) has the molecular formula C24H44FN and a molecular weight of 365.62 g/mol. Its IUPAC name is butane;N,4-dimethylaniline;(2Z,4E)-3-ethyl-4-fluorohexa-2,4-diene.
| Compound Name | butane;N,4-dimethylaniline;(2Z,4E)-3-ethyl-4-fluorohexa-2,4-diene |
|---|---|
| PubChem CID | 143844335 |
| Molecular Formula | C24H44FN |
| Molecular Weight | 365.62 g/mol |
| Exact Mass | 365.35 |
| IUPAC Name | butane;N,4-dimethylaniline;(2Z,4E)-3-ethyl-4-fluorohexa-2,4-diene |
| SMILES | C/C=C(CC)\C(F)=C/C.CCCC.CCCC.CNc1ccc(C)cc1 |
| InChI | InChI=1S/C8H13F.C8H11N.2C4H10/c1-4-7(5-2)8(9)6-3;1-7-3-5-8(9-2)6-4-7;2*1-3-4-2/h4,6H,5H2,1-3H3;3-6,9H,1-2H3;2*3-4H2,1-2H3/b7-4-,8-6+;;; |
| InChIKey | LDVZWPUEMOAMLO-NCJNTBRTSA-N |
| XLogP | 8.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.62 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|