About 3-ethenylphenol;methanol;4-methylphenol
3-ethenylphenol;methanol;4-methylphenol (PubChem CID 144866816) has the molecular formula C16H20O3
and a molecular weight of 260.33 g/mol. Its IUPAC name is 3-ethenylphenol;methanol;4-methylphenol.
Molecular Properties
| Compound Name | 3-ethenylphenol;methanol;4-methylphenol |
| PubChem CID | 144866816 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 3-ethenylphenol;methanol;4-methylphenol |
| SMILES | C=Cc1cccc(O)c1.CO.Cc1ccc(O)cc1 |
| InChI | InChI=1S/C8H8O.C7H8O.CH4O/c1-2-7-4-3-5-8(9)6-7;1-6-2-4-7(8)5-3-6;1-2/h2-6,9H,1H2;2-5,8H,1H3;2H,1H3 |
| InChIKey | UOSIHMQBDCLFDX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethenylphenol;methanol;4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenylphenol;methanol;4-methylphenol?
The IUPAC name of 3-ethenylphenol;methanol;4-methylphenol (CID 144866816) is 3-ethenylphenol;methanol;4-methylphenol.
What is the SMILES notation for 3-ethenylphenol;methanol;4-methylphenol?
The canonical SMILES for 3-ethenylphenol;methanol;4-methylphenol is C=Cc1cccc(O)c1.CO.Cc1ccc(O)cc1.
What is the InChIKey of 3-ethenylphenol;methanol;4-methylphenol?
The InChIKey is UOSIHMQBDCLFDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C7H8O.CH4O/c1-2-7-4-3-5-8(9)6-7;1-6-2-4-7(8)5-3-6;1-2/h2-6,9H,1H2;2-5,8H,1H3;2H,1H3.
What are the key properties of 3-ethenylphenol;methanol;4-methylphenol?
3-ethenylphenol;methanol;4-methylphenol has a molecular weight of 260.33 g/mol, XLogP of 3.34, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenylphenol;methanol;4-methylphenol is sourced from PubChem (CID 144866816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).