C19H22N2O2 — CID 134248638
aniline;benzene-1,4-diol;2-methylaniline (PubChem CID 134248638) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is aniline;benzene-1,4-diol;2-methylaniline.
| Compound Name | aniline;benzene-1,4-diol;2-methylaniline |
|---|---|
| PubChem CID | 134248638 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | aniline;benzene-1,4-diol;2-methylaniline |
| SMILES | Cc1ccccc1N.Nc1ccccc1.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C7H9N.C6H7N.C6H6O2/c1-6-4-2-3-5-7(6)8;7-6-4-2-1-3-5-6;7-5-1-2-6(8)4-3-5/h2-5H,8H2,1H3;1-5H,7H2;1-4,7-8H |
| InChIKey | DNXYYMKHGNSQDS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|