About aniline;benzene-1,4-diol;2-methylaniline
aniline;benzene-1,4-diol;2-methylaniline (PubChem CID 134248638) has the molecular formula C19H22N2O2
and a molecular weight of 310.40 g/mol. Its IUPAC name is aniline;benzene-1,4-diol;2-methylaniline.
Molecular Properties
| Compound Name | aniline;benzene-1,4-diol;2-methylaniline |
| PubChem CID | 134248638 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | aniline;benzene-1,4-diol;2-methylaniline |
| SMILES | Cc1ccccc1N.Nc1ccccc1.Oc1ccc(O)cc1 |
| InChI | InChI=1S/C7H9N.C6H7N.C6H6O2/c1-6-4-2-3-5-7(6)8;7-6-4-2-1-3-5-6;7-5-1-2-6(8)4-3-5/h2-5H,8H2,1H3;1-5H,7H2;1-4,7-8H |
| InChIKey | DNXYYMKHGNSQDS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze aniline;benzene-1,4-diol;2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;benzene-1,4-diol;2-methylaniline?
The IUPAC name of aniline;benzene-1,4-diol;2-methylaniline (CID 134248638) is aniline;benzene-1,4-diol;2-methylaniline.
What is the SMILES notation for aniline;benzene-1,4-diol;2-methylaniline?
The canonical SMILES for aniline;benzene-1,4-diol;2-methylaniline is Cc1ccccc1N.Nc1ccccc1.Oc1ccc(O)cc1.
What is the InChIKey of aniline;benzene-1,4-diol;2-methylaniline?
The InChIKey is DNXYYMKHGNSQDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.C6H7N.C6H6O2/c1-6-4-2-3-5-7(6)8;7-6-4-2-1-3-5-6;7-5-1-2-6(8)4-3-5/h2-5H,8H2,1H3;1-5H,7H2;1-4,7-8H.
What are the key properties of aniline;benzene-1,4-diol;2-methylaniline?
aniline;benzene-1,4-diol;2-methylaniline has a molecular weight of 310.40 g/mol, XLogP of 3.94, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;benzene-1,4-diol;2-methylaniline is sourced from PubChem (CID 134248638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).