C11H16O2 — CID 143881724
methyl formate;1,2,4-trimethylbenzene (PubChem CID 143881724) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is methyl formate;1,2,4-trimethylbenzene.
| Compound Name | methyl formate;1,2,4-trimethylbenzene |
|---|---|
| PubChem CID | 143881724 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | methyl formate;1,2,4-trimethylbenzene |
| SMILES | COC=O.Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C9H12.C2H4O2/c1-7-4-5-8(2)9(3)6-7;1-4-2-3/h4-6H,1-3H3;2H,1H3 |
| InChIKey | IHBBWIHJHUIREG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|