C10H15NO2 — CID 143511475
N,3-dimethylaniline;methyl formate (PubChem CID 143511475) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is N,3-dimethylaniline;methyl formate.
| Compound Name | N,3-dimethylaniline;methyl formate |
|---|---|
| PubChem CID | 143511475 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N,3-dimethylaniline;methyl formate |
| SMILES | CNc1cccc(C)c1.COC=O |
| InChI | InChI=1S/C8H11N.C2H4O2/c1-7-4-3-5-8(6-7)9-2;1-4-2-3/h3-6,9H,1-2H3;2H,1H3 |
| InChIKey | SFZJHJQLPIBXKC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|