About (3-methylanilino)azanium
(3-methylanilino)azanium (PubChem CID 4555748) has the molecular formula C7H11N2+
and a molecular weight of 123.18 g/mol. Its IUPAC name is (3-methylanilino)azanium.
Molecular Properties
| Compound Name | (3-methylanilino)azanium |
| PubChem CID | 4555748 |
| Molecular Formula | C7H11N2+ |
| Molecular Weight | 123.18 g/mol |
| Exact Mass | 123.09 |
| IUPAC Name | (3-methylanilino)azanium |
| SMILES | Cc1cccc(N[NH3+])c1 |
| InChI | InChI=1S/C7H10N2/c1-6-3-2-4-7(5-6)9-8/h2-5,9H,8H2,1H3/p+1 |
| InChIKey | GPTOGZLZMLJZCV-UHFFFAOYSA-O |
| XLogP | 0.56 |
| TPSA | 39.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.18 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-methylanilino)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylanilino)azanium?
The IUPAC name of (3-methylanilino)azanium (CID 4555748) is (3-methylanilino)azanium.
What is the SMILES notation for (3-methylanilino)azanium?
The canonical SMILES for (3-methylanilino)azanium is Cc1cccc(N[NH3+])c1.
What is the InChIKey of (3-methylanilino)azanium?
The InChIKey is GPTOGZLZMLJZCV-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H10N2/c1-6-3-2-4-7(5-6)9-8/h2-5,9H,8H2,1H3/p+1.
What are the key properties of (3-methylanilino)azanium?
(3-methylanilino)azanium has a molecular weight of 123.18 g/mol, XLogP of 0.56, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylanilino)azanium is sourced from PubChem (CID 4555748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).